C15H22F6N2 — CID 167204658
N-ethyl-N-pentan-2-yl-N'-[(2Z)-1,1,1-trifluoro-4-(trifluoromethyl)penta-2,4-dien-2-yl]ethanimidamide (PubChem CID 167204658) has the molecular formula C15H22F6N2 and a molecular weight of 344.34 g/mol. Its IUPAC name is N-ethyl-N-pentan-2-yl-N'-[(2Z)-1,1,1-trifluoro-4-(trifluoromethyl)penta-2,4-dien-2-yl]ethanimidamide.
| Compound Name | N-ethyl-N-pentan-2-yl-N'-[(2Z)-1,1,1-trifluoro-4-(trifluoromethyl)penta-2,4-dien-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 167204658 |
| Molecular Formula | C15H22F6N2 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-ethyl-N-pentan-2-yl-N'-[(2Z)-1,1,1-trifluoro-4-(trifluoromethyl)penta-2,4-dien-2-yl]ethanimidamide |
| SMILES | C=C(/C=C(\N=C(/C)N(CC)C(C)CCC)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H22F6N2/c1-6-8-11(4)23(7-2)12(5)22-13(15(19,20)21)9-10(3)14(16,17)18/h9,11H,3,6-8H2,1-2,4-5H3/b13-9-,22-12+ |
| InChIKey | UHXJACFFSFILLD-KNYLEKKXSA-N |
| XLogP | 5.48 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|