C14H22FN3 — CID 167204679
1-ethyl-1-[2-[(3Z)-3-[(2E)-2-fluoropenta-2,4-dienylidene]-1,2-dihydropyrrol-4-yl]ethyl]-2-methylhydrazine (PubChem CID 167204679) has the molecular formula C14H22FN3 and a molecular weight of 251.35 g/mol. Its IUPAC name is 1-ethyl-1-[2-[(3Z)-3-[(2E)-2-fluoropenta-2,4-dienylidene]-1,2-dihydropyrrol-4-yl]ethyl]-2-methylhydrazine.
| Compound Name | 1-ethyl-1-[2-[(3Z)-3-[(2E)-2-fluoropenta-2,4-dienylidene]-1,2-dihydropyrrol-4-yl]ethyl]-2-methylhydrazine |
|---|---|
| PubChem CID | 167204679 |
| Molecular Formula | C14H22FN3 |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.18 |
| IUPAC Name | 1-ethyl-1-[2-[(3Z)-3-[(2E)-2-fluoropenta-2,4-dienylidene]-1,2-dihydropyrrol-4-yl]ethyl]-2-methylhydrazine |
| SMILES | C=C/C=C(F)\C=C1/CNC=C1CCN(CC)NC |
| InChI | InChI=1S/C14H22FN3/c1-4-6-14(15)9-13-11-17-10-12(13)7-8-18(5-2)16-3/h4,6,9-10,16-17H,1,5,7-8,11H2,2-3H3/b13-9+,14-6+ |
| InChIKey | PLHBRDBOMGBPSS-WSPXSRFVSA-N |
| XLogP | 2.29 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|