About N-(ethoxymethyl)-N,2-dimethylhexan-1-amine
N-(ethoxymethyl)-N,2-dimethylhexan-1-amine (PubChem CID 167205147) has the molecular formula C11H25NO
and a molecular weight of 187.33 g/mol. Its IUPAC name is N-(ethoxymethyl)-N,2-dimethylhexan-1-amine.
Molecular Properties
| Compound Name | N-(ethoxymethyl)-N,2-dimethylhexan-1-amine |
| PubChem CID | 167205147 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | N-(ethoxymethyl)-N,2-dimethylhexan-1-amine |
| SMILES | CCCCC(C)CN(C)COCC |
| InChI | InChI=1S/C11H25NO/c1-5-7-8-11(3)9-12(4)10-13-6-2/h11H,5-10H2,1-4H3 |
| InChIKey | VLIKKQAXKGKDPY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(ethoxymethyl)-N,2-dimethylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(ethoxymethyl)-N,2-dimethylhexan-1-amine?
The IUPAC name of N-(ethoxymethyl)-N,2-dimethylhexan-1-amine (CID 167205147) is N-(ethoxymethyl)-N,2-dimethylhexan-1-amine.
What is the SMILES notation for N-(ethoxymethyl)-N,2-dimethylhexan-1-amine?
The canonical SMILES for N-(ethoxymethyl)-N,2-dimethylhexan-1-amine is CCCCC(C)CN(C)COCC.
What is the InChIKey of N-(ethoxymethyl)-N,2-dimethylhexan-1-amine?
The InChIKey is VLIKKQAXKGKDPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25NO/c1-5-7-8-11(3)9-12(4)10-13-6-2/h11H,5-10H2,1-4H3.
What are the key properties of N-(ethoxymethyl)-N,2-dimethylhexan-1-amine?
N-(ethoxymethyl)-N,2-dimethylhexan-1-amine has a molecular weight of 187.33 g/mol, XLogP of 2.74, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(ethoxymethyl)-N,2-dimethylhexan-1-amine is sourced from PubChem (CID 167205147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).