C23H24N2O — CID 16720553
(1S,13R,14R)-24-methyl-4,24-diazahexacyclo[12.7.3.01,13.03,11.05,10.016,21]tetracosa-3(11),5,7,9,16(21),17,19-heptaen-19-ol (PubChem CID 16720553) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is (1S,13R,14R)-24-methyl-4,24-diazahexacyclo[12.7.3.01,13.03,11.05,10.016,21]tetracosa-3(11),5,7,9,16(21),17,19-heptaen-19-ol.
| Compound Name | (1S,13R,14R)-24-methyl-4,24-diazahexacyclo[12.7.3.01,13.03,11.05,10.016,21]tetracosa-3(11),5,7,9,16(21),17,19-heptaen-19-ol |
|---|---|
| PubChem CID | 16720553 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | (1S,13R,14R)-24-methyl-4,24-diazahexacyclo[12.7.3.01,13.03,11.05,10.016,21]tetracosa-3(11),5,7,9,16(21),17,19-heptaen-19-ol |
| SMILES | CN1CC[C@]23Cc4[nH]c5ccccc5c4C[C@H]2[C@H]1Cc1ccc(O)cc13 |
| InChI | InChI=1S/C23H24N2O/c1-25-9-8-23-13-21-17(16-4-2-3-5-20(16)24-21)12-19(23)22(25)10-14-6-7-15(26)11-18(14)23/h2-7,11,19,22,24,26H,8-10,12-13H2,1H3/t19-,22+,23+/m0/s1 |
| InChIKey | SGSVRERBPLEULM-WWPVKYPJSA-N |
| XLogP | 3.79 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|