C28H39FN6O2 — CID 167206702
1-(2-fluorophenyl)-3-[2-[4-(4-methoxybutoxy)butyl]-2,7-diazaspiro[3.5]nonan-7-yl]imidazo[1,5-a]pyrazin-8-amine (PubChem CID 167206702) has the molecular formula C28H39FN6O2 and a molecular weight of 510.66 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[2-[4-(4-methoxybutoxy)butyl]-2,7-diazaspiro[3.5]nonan-7-yl]imidazo[1,5-a]pyrazin-8-amine.
| Compound Name | 1-(2-fluorophenyl)-3-[2-[4-(4-methoxybutoxy)butyl]-2,7-diazaspiro[3.5]nonan-7-yl]imidazo[1,5-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 167206702 |
| Molecular Formula | C28H39FN6O2 |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.31 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[2-[4-(4-methoxybutoxy)butyl]-2,7-diazaspiro[3.5]nonan-7-yl]imidazo[1,5-a]pyrazin-8-amine |
| SMILES | COCCCCOCCCCN1CC2(CCN(c3nc(-c4ccccc4F)c4c(N)nccn34)CC2)C1 |
| InChI | InChI=1S/C28H39FN6O2/c1-36-17-6-7-19-37-18-5-4-13-33-20-28(21-33)10-14-34(15-11-28)27-32-24(22-8-2-3-9-23(22)29)25-26(30)31-12-16-35(25)27/h2-3,8-9,12,16H,4-7,10-11,13-15,17-21H2,1H3,(H2,30,31) |
| InChIKey | AZUHMNFCZYNQDL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|