C16H20N2 — CID 167206818
N-[(E)-[(3E)-3-[(Z)-prop-1-enyl]hepta-3,6-dien-2-ylidene]amino]aniline (PubChem CID 167206818) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is N-[(E)-[(3E)-3-[(Z)-prop-1-enyl]hepta-3,6-dien-2-ylidene]amino]aniline.
| Compound Name | N-[(E)-[(3E)-3-[(Z)-prop-1-enyl]hepta-3,6-dien-2-ylidene]amino]aniline |
|---|---|
| PubChem CID | 167206818 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | N-[(E)-[(3E)-3-[(Z)-prop-1-enyl]hepta-3,6-dien-2-ylidene]amino]aniline |
| SMILES | C=CC/C=C(\C=C/C)C(/C)=N/Nc1ccccc1 |
| InChI | InChI=1S/C16H20N2/c1-4-6-11-15(10-5-2)14(3)17-18-16-12-8-7-9-13-16/h4-5,7-13,18H,1,6H2,2-3H3/b10-5-,15-11+,17-14+ |
| InChIKey | UPBWCOGDGSSVGM-YHBMQDMVSA-N |
| XLogP | 4.55 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|