C20H33N3 — CID 167207015
(3Z,5E,7E,9Z)-7-ethylidene-5-methanimidoyl-N,9,10-trimethyl-8-methyliminotrideca-3,5,9-trien-4-amine (PubChem CID 167207015) has the molecular formula C20H33N3 and a molecular weight of 315.50 g/mol. Its IUPAC name is (3Z,5E,7E,9Z)-7-ethylidene-5-methanimidoyl-N,9,10-trimethyl-8-methyliminotrideca-3,5,9-trien-4-amine.
| Compound Name | (3Z,5E,7E,9Z)-7-ethylidene-5-methanimidoyl-N,9,10-trimethyl-8-methyliminotrideca-3,5,9-trien-4-amine |
|---|---|
| PubChem CID | 167207015 |
| Molecular Formula | C20H33N3 |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.27 |
| IUPAC Name | (3Z,5E,7E,9Z)-7-ethylidene-5-methanimidoyl-N,9,10-trimethyl-8-methyliminotrideca-3,5,9-trien-4-amine |
| SMILES | [H]/N=C/C(=C/C(=C/C)C(=NC)/C(C)=C(/C)CCC)/C(=C/CC)NC |
| InChI | InChI=1S/C20H33N3/c1-8-11-15(4)16(5)20(23-7)17(10-3)13-18(14-21)19(22-6)12-9-2/h10,12-14,21-22H,8-9,11H2,1-7H3/b16-15-,17-10-,18-13-,19-12-,21-14+,23-20+ |
| InChIKey | KRKUOOAXYHQZRV-MEKQXTLGSA-N |
| XLogP | 5.23 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|