C22H24N4O — CID 167207156
(1R,1aR,6aS)-4-[2-[(2S)-2-methylazetidin-1-yl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxamide (PubChem CID 167207156) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is (1R,1aR,6aS)-4-[2-[(2S)-2-methylazetidin-1-yl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxamide.
| Compound Name | (1R,1aR,6aS)-4-[2-[(2S)-2-methylazetidin-1-yl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxamide |
|---|---|
| PubChem CID | 167207156 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (1R,1aR,6aS)-4-[2-[(2S)-2-methylazetidin-1-yl]-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxamide |
| SMILES | C[C@H]1CCN1c1nc2c(c(-c3ccc4c(c3)C[C@@H]3[C@@H](C(N)=O)[C@H]43)n1)CCC2 |
| InChI | InChI=1S/C22H24N4O/c1-11-7-8-26(11)22-24-17-4-2-3-15(17)20(25-22)12-5-6-14-13(9-12)10-16-18(14)19(16)21(23)27/h5-6,9,11,16,18-19H,2-4,7-8,10H2,1H3,(H2,23,27)/t11-,16-,18+,19+/m0/s1 |
| InChIKey | XROQDYMSLSLPHE-NDCLTGCFSA-N |
| XLogP | 2.60 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |