About 4-[[(E)-4-ethenyl-3,8-dimethyldec-7-en-2-ylidene]amino]butan-1-amine
4-[[(E)-4-ethenyl-3,8-dimethyldec-7-en-2-ylidene]amino]butan-1-amine (PubChem CID 167207524) has the molecular formula C18H34N2
and a molecular weight of 278.48 g/mol. Its IUPAC name is 4-[[(E)-4-ethenyl-3,8-dimethyldec-7-en-2-ylidene]amino]butan-1-amine.
Molecular Properties
| Compound Name | 4-[[(E)-4-ethenyl-3,8-dimethyldec-7-en-2-ylidene]amino]butan-1-amine |
| PubChem CID | 167207524 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | 4-[[(E)-4-ethenyl-3,8-dimethyldec-7-en-2-ylidene]amino]butan-1-amine |
| SMILES | C=CC(CC/C=C(\C)CC)C(C)/C(C)=N/CCCCN |
| InChI | InChI=1S/C18H34N2/c1-6-15(3)11-10-12-18(7-2)16(4)17(5)20-14-9-8-13-19/h7,11,16,18H,2,6,8-10,12-14,19H2,1,3-5H3/b15-11+,20-17+ |
| InChIKey | RMMPULWCJKEILL-FHLMLCIISA-N |
| XLogP | 4.76 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(E)-4-ethenyl-3,8-dimethyldec-7-en-2-ylidene]amino]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(E)-4-ethenyl-3,8-dimethyldec-7-en-2-ylidene]amino]butan-1-amine?
The IUPAC name of 4-[[(E)-4-ethenyl-3,8-dimethyldec-7-en-2-ylidene]amino]butan-1-amine (CID 167207524) is 4-[[(E)-4-ethenyl-3,8-dimethyldec-7-en-2-ylidene]amino]butan-1-amine.
What is the SMILES notation for 4-[[(E)-4-ethenyl-3,8-dimethyldec-7-en-2-ylidene]amino]butan-1-amine?
The canonical SMILES for 4-[[(E)-4-ethenyl-3,8-dimethyldec-7-en-2-ylidene]amino]butan-1-amine is C=CC(CC/C=C(\C)CC)C(C)/C(C)=N/CCCCN.
What is the InChIKey of 4-[[(E)-4-ethenyl-3,8-dimethyldec-7-en-2-ylidene]amino]butan-1-amine?
The InChIKey is RMMPULWCJKEILL-FHLMLCIISA-N. The full InChI is InChI=1S/C18H34N2/c1-6-15(3)11-10-12-18(7-2)16(4)17(5)20-14-9-8-13-19/h7,11,16,18H,2,6,8-10,12-14,19H2,1,3-5H3/b15-11+,20-17+.
What are the key properties of 4-[[(E)-4-ethenyl-3,8-dimethyldec-7-en-2-ylidene]amino]butan-1-amine?
4-[[(E)-4-ethenyl-3,8-dimethyldec-7-en-2-ylidene]amino]butan-1-amine has a molecular weight of 278.48 g/mol, XLogP of 4.76, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(E)-4-ethenyl-3,8-dimethyldec-7-en-2-ylidene]amino]butan-1-amine is sourced from PubChem (CID 167207524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).