C6H9F8N3 — CID 167208038
N",N"-dimethyl-N-(1,1,2,2,2-pentafluoroethyl)-N'-(trifluoromethyl)methanetriamine (PubChem CID 167208038) has the molecular formula C6H9F8N3 and a molecular weight of 275.14 g/mol. Its IUPAC name is N",N"-dimethyl-N-(1,1,2,2,2-pentafluoroethyl)-N'-(trifluoromethyl)methanetriamine.
| Compound Name | N",N"-dimethyl-N-(1,1,2,2,2-pentafluoroethyl)-N'-(trifluoromethyl)methanetriamine |
|---|---|
| PubChem CID | 167208038 |
| Molecular Formula | C6H9F8N3 |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | N",N"-dimethyl-N-(1,1,2,2,2-pentafluoroethyl)-N'-(trifluoromethyl)methanetriamine |
| SMILES | CN(C)C(NC(F)(F)F)NC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H9F8N3/c1-17(2)3(16-6(12,13)14)15-5(10,11)4(7,8)9/h3,15-16H,1-2H3 |
| InChIKey | OXCDBALARVLETB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|