C25H33FN2O2S — CID 167208228
7-(ethylsulfanylamino)-6-[[4-(2-fluorophenyl)cyclohexyl]oxymethyl]-3-methyl-6,7,8,9-tetrahydroquinolizin-4-one (PubChem CID 167208228) has the molecular formula C25H33FN2O2S and a molecular weight of 444.62 g/mol. Its IUPAC name is 7-(ethylsulfanylamino)-6-[[4-(2-fluorophenyl)cyclohexyl]oxymethyl]-3-methyl-6,7,8,9-tetrahydroquinolizin-4-one.
| Compound Name | 7-(ethylsulfanylamino)-6-[[4-(2-fluorophenyl)cyclohexyl]oxymethyl]-3-methyl-6,7,8,9-tetrahydroquinolizin-4-one |
|---|---|
| PubChem CID | 167208228 |
| Molecular Formula | C25H33FN2O2S |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 7-(ethylsulfanylamino)-6-[[4-(2-fluorophenyl)cyclohexyl]oxymethyl]-3-methyl-6,7,8,9-tetrahydroquinolizin-4-one |
| SMILES | CCSNC1CCc2ccc(C)c(=O)n2C1COC1CCC(c2ccccc2F)CC1 |
| InChI | InChI=1S/C25H33FN2O2S/c1-3-31-27-23-15-12-19-11-8-17(2)25(29)28(19)24(23)16-30-20-13-9-18(10-14-20)21-6-4-5-7-22(21)26/h4-8,11,18,20,23-24,27H,3,9-10,12-16H2,1-2H3 |
| InChIKey | UJQAGLBYXPVLFU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|