C31H25F6NS — CID 167208386
15-(4-tert-butylnaphthalen-2-yl)-3,3,4,4,6,6-hexafluoro-5,5-dimethyl-17-thia-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene (PubChem CID 167208386) has the molecular formula C31H25F6NS and a molecular weight of 557.60 g/mol. Its IUPAC name is 15-(4-tert-butylnaphthalen-2-yl)-3,3,4,4,6,6-hexafluoro-5,5-dimethyl-17-thia-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene.
| Compound Name | 15-(4-tert-butylnaphthalen-2-yl)-3,3,4,4,6,6-hexafluoro-5,5-dimethyl-17-thia-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene |
|---|---|
| PubChem CID | 167208386 |
| Molecular Formula | C31H25F6NS |
| Molecular Weight | 557.60 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | 15-(4-tert-butylnaphthalen-2-yl)-3,3,4,4,6,6-hexafluoro-5,5-dimethyl-17-thia-14-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),8,11(16),12,14-hexaene |
| SMILES | CC(C)(C)c1cc(-c2nccc3c2sc2c4c(ccc23)C(F)(F)C(C)(C)C(F)(F)C4(F)F)cc2ccccc12 |
| InChI | InChI=1S/C31H25F6NS/c1-27(2,3)22-15-17(14-16-8-6-7-9-18(16)22)24-26-20(12-13-38-24)19-10-11-21-23(25(19)39-26)30(34,35)31(36,37)28(4,5)29(21,32)33/h6-15H,1-5H3 |
| InChIKey | ZEAPDAHSTYMOMQ-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.60 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|