C25H32Cl3NO4Si — CID 16720902
N-[(3S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-4-(methoxymethoxy)pent-1-en-3-yl]-2,2,2-trichloroacetamide (PubChem CID 16720902) has the molecular formula C25H32Cl3NO4Si and a molecular weight of 544.98 g/mol. Its IUPAC name is N-[(3S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-4-(methoxymethoxy)pent-1-en-3-yl]-2,2,2-trichloroacetamide.
| Compound Name | N-[(3S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-4-(methoxymethoxy)pent-1-en-3-yl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 16720902 |
| Molecular Formula | C25H32Cl3NO4Si |
| Molecular Weight | 544.98 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | N-[(3S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-4-(methoxymethoxy)pent-1-en-3-yl]-2,2,2-trichloroacetamide |
| SMILES | C=C[C@H](NC(=O)C(Cl)(Cl)Cl)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCOC |
| InChI | InChI=1S/C25H32Cl3NO4Si/c1-6-21(29-23(30)25(26,27)28)22(32-18-31-5)17-33-34(24(2,3)4,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h6-16,21-22H,1,17-18H2,2-5H3,(H,29,30)/t21-,22+/m0/s1 |
| InChIKey | YRRTTZSBFAUATR-FCHUYYIVSA-N |
| XLogP | 4.59 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.98 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|