About 4-amino-2,3-dimethylcyclobuta-1,3-dien-1-ol
4-amino-2,3-dimethylcyclobuta-1,3-dien-1-ol (PubChem CID 167209027) has the molecular formula C6H9NO
and a molecular weight of 111.14 g/mol. Its IUPAC name is 4-amino-2,3-dimethylcyclobuta-1,3-dien-1-ol.
Molecular Properties
| Compound Name | 4-amino-2,3-dimethylcyclobuta-1,3-dien-1-ol |
| PubChem CID | 167209027 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.14 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | 4-amino-2,3-dimethylcyclobuta-1,3-dien-1-ol |
| SMILES | CC1=C(N)C(O)=C1C |
| InChI | InChI=1S/C6H9NO/c1-3-4(2)6(8)5(3)7/h8H,7H2,1-2H3 |
| InChIKey | USPXWBNPGJHJOA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.14 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-2,3-dimethylcyclobuta-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,3-dimethylcyclobuta-1,3-dien-1-ol?
The IUPAC name of 4-amino-2,3-dimethylcyclobuta-1,3-dien-1-ol (CID 167209027) is 4-amino-2,3-dimethylcyclobuta-1,3-dien-1-ol.
What is the SMILES notation for 4-amino-2,3-dimethylcyclobuta-1,3-dien-1-ol?
The canonical SMILES for 4-amino-2,3-dimethylcyclobuta-1,3-dien-1-ol is CC1=C(N)C(O)=C1C.
What is the InChIKey of 4-amino-2,3-dimethylcyclobuta-1,3-dien-1-ol?
The InChIKey is USPXWBNPGJHJOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO/c1-3-4(2)6(8)5(3)7/h8H,7H2,1-2H3.
What are the key properties of 4-amino-2,3-dimethylcyclobuta-1,3-dien-1-ol?
4-amino-2,3-dimethylcyclobuta-1,3-dien-1-ol has a molecular weight of 111.14 g/mol, XLogP of 1.06, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,3-dimethylcyclobuta-1,3-dien-1-ol is sourced from PubChem (CID 167209027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).