C22H27N5O3S — CID 167209120
3-tert-butyl-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-1-[2-(2-methoxyphenyl)ethyl]-5-methylthieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 167209120) has the molecular formula C22H27N5O3S and a molecular weight of 441.56 g/mol. Its IUPAC name is 3-tert-butyl-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-1-[2-(2-methoxyphenyl)ethyl]-5-methylthieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 3-tert-butyl-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-1-[2-(2-methoxyphenyl)ethyl]-5-methylthieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 167209120 |
| Molecular Formula | C22H27N5O3S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 3-tert-butyl-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-1-[2-(2-methoxyphenyl)ethyl]-5-methylthieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | [H]/N=C/C=N\Nc1sc2c(c1C)c(=O)n(C(C)(C)C)c(=O)n2CCc1ccccc1OC |
| InChI | InChI=1S/C22H27N5O3S/c1-14-17-19(28)27(22(2,3)4)21(29)26(20(17)31-18(14)25-24-12-11-23)13-10-15-8-6-7-9-16(15)30-5/h6-9,11-12,23,25H,10,13H2,1-5H3/b23-11+,24-12- |
| InChIKey | WABIYAUZKYIORO-KPOZEHODSA-N |
| XLogP | 3.59 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|