C12H19F3N2O2S — CID 167209544
S-[(2S)-3-(cyclohexylamino)-2-(methylamino)-3-oxopropyl] 2,2,2-trifluoroethanethioate (PubChem CID 167209544) has the molecular formula C12H19F3N2O2S and a molecular weight of 312.36 g/mol. Its IUPAC name is S-[(2S)-3-(cyclohexylamino)-2-(methylamino)-3-oxopropyl] 2,2,2-trifluoroethanethioate.
| Compound Name | S-[(2S)-3-(cyclohexylamino)-2-(methylamino)-3-oxopropyl] 2,2,2-trifluoroethanethioate |
|---|---|
| PubChem CID | 167209544 |
| Molecular Formula | C12H19F3N2O2S |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | S-[(2S)-3-(cyclohexylamino)-2-(methylamino)-3-oxopropyl] 2,2,2-trifluoroethanethioate |
| SMILES | CN[C@H](CSC(=O)C(F)(F)F)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C12H19F3N2O2S/c1-16-9(7-20-11(19)12(13,14)15)10(18)17-8-5-3-2-4-6-8/h8-9,16H,2-7H2,1H3,(H,17,18)/t9-/m1/s1 |
| InChIKey | RLNUBFVYRBEPBC-SECBINFHSA-N |
| XLogP | 1.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|