About (2E,4Z)-4-(oxan-4-yl)hexa-2,4-diene-2-thiol
(2E,4Z)-4-(oxan-4-yl)hexa-2,4-diene-2-thiol (PubChem CID 167210204) has the molecular formula C11H18OS
and a molecular weight of 198.33 g/mol. Its IUPAC name is (2E,4Z)-4-(oxan-4-yl)hexa-2,4-diene-2-thiol.
Molecular Properties
| Compound Name | (2E,4Z)-4-(oxan-4-yl)hexa-2,4-diene-2-thiol |
| PubChem CID | 167210204 |
| Molecular Formula | C11H18OS |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | (2E,4Z)-4-(oxan-4-yl)hexa-2,4-diene-2-thiol |
| SMILES | C/C=C(\C=C(/C)S)C1CCOCC1 |
| InChI | InChI=1S/C11H18OS/c1-3-10(8-9(2)13)11-4-6-12-7-5-11/h3,8,11,13H,4-7H2,1-2H3/b9-8+,10-3+ |
| InChIKey | URAMVPGCJOGHRR-UTDLVPNFSA-N |
| XLogP | 3.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-4-(oxan-4-yl)hexa-2,4-diene-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-4-(oxan-4-yl)hexa-2,4-diene-2-thiol?
The IUPAC name of (2E,4Z)-4-(oxan-4-yl)hexa-2,4-diene-2-thiol (CID 167210204) is (2E,4Z)-4-(oxan-4-yl)hexa-2,4-diene-2-thiol.
What is the SMILES notation for (2E,4Z)-4-(oxan-4-yl)hexa-2,4-diene-2-thiol?
The canonical SMILES for (2E,4Z)-4-(oxan-4-yl)hexa-2,4-diene-2-thiol is C/C=C(\C=C(/C)S)C1CCOCC1.
What is the InChIKey of (2E,4Z)-4-(oxan-4-yl)hexa-2,4-diene-2-thiol?
The InChIKey is URAMVPGCJOGHRR-UTDLVPNFSA-N. The full InChI is InChI=1S/C11H18OS/c1-3-10(8-9(2)13)11-4-6-12-7-5-11/h3,8,11,13H,4-7H2,1-2H3/b9-8+,10-3+.
What are the key properties of (2E,4Z)-4-(oxan-4-yl)hexa-2,4-diene-2-thiol?
(2E,4Z)-4-(oxan-4-yl)hexa-2,4-diene-2-thiol has a molecular weight of 198.33 g/mol, XLogP of 3.19, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-4-(oxan-4-yl)hexa-2,4-diene-2-thiol is sourced from PubChem (CID 167210204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).