C11H16F3N — CID 167210327
(3E,5Z)-N,N-dimethyl-4-(trifluoromethyl)octa-1,3,5-trien-2-amine (PubChem CID 167210327) has the molecular formula C11H16F3N and a molecular weight of 219.25 g/mol. Its IUPAC name is (3E,5Z)-N,N-dimethyl-4-(trifluoromethyl)octa-1,3,5-trien-2-amine.
| Compound Name | (3E,5Z)-N,N-dimethyl-4-(trifluoromethyl)octa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 167210327 |
| Molecular Formula | C11H16F3N |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | (3E,5Z)-N,N-dimethyl-4-(trifluoromethyl)octa-1,3,5-trien-2-amine |
| SMILES | C=C(/C=C(\C=C/CC)C(F)(F)F)N(C)C |
| InChI | InChI=1S/C11H16F3N/c1-5-6-7-10(11(12,13)14)8-9(2)15(3)4/h6-8H,2,5H2,1,3-4H3/b7-6-,10-8+ |
| InChIKey | KDMUJMGYTNYKLU-VAAURPRASA-N |
| XLogP | 3.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|