C20H30N2O8 — CID 16721047
N-phenyl-N'-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctanediamide (PubChem CID 16721047) has the molecular formula C20H30N2O8 and a molecular weight of 426.47 g/mol. Its IUPAC name is N-phenyl-N'-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctanediamide.
| Compound Name | N-phenyl-N'-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctanediamide |
|---|---|
| PubChem CID | 16721047 |
| Molecular Formula | C20H30N2O8 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | N-phenyl-N'-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoctanediamide |
| SMILES | O=C(CCCCCCC(=O)Nc1ccccc1)NO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H30N2O8/c23-12-14-17(26)18(27)19(28)20(29-14)30-22-16(25)11-7-2-1-6-10-15(24)21-13-8-4-3-5-9-13/h3-5,8-9,14,17-20,23,26-28H,1-2,6-7,10-12H2,(H,21,24)(H,22,25)/t14-,17+,18+,19-,20+/m1/s1 |
| InChIKey | OEIIJWJORBAQLR-OITRIXBGSA-N |
| XLogP | -0.19 |
| TPSA | 157.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|