C47H36N4O4 — CID 167210685
8-[2-[2-[4-[3-(2-aminoethyl)phenyl]phenyl]ethyl]-1,3-dioxobenzo[de]isoquinolin-6-yl]-3-(2-phenylethyl)-3,7-diazatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione (PubChem CID 167210685) has the molecular formula C47H36N4O4 and a molecular weight of 720.83 g/mol. Its IUPAC name is 8-[2-[2-[4-[3-(2-aminoethyl)phenyl]phenyl]ethyl]-1,3-dioxobenzo[de]isoquinolin-6-yl]-3-(2-phenylethyl)-3,7-diazatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione.
| Compound Name | 8-[2-[2-[4-[3-(2-aminoethyl)phenyl]phenyl]ethyl]-1,3-dioxobenzo[de]isoquinolin-6-yl]-3-(2-phenylethyl)-3,7-diazatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione |
|---|---|
| PubChem CID | 167210685 |
| Molecular Formula | C47H36N4O4 |
| Molecular Weight | 720.83 g/mol |
| Exact Mass | 720.27 |
| IUPAC Name | 8-[2-[2-[4-[3-(2-aminoethyl)phenyl]phenyl]ethyl]-1,3-dioxobenzo[de]isoquinolin-6-yl]-3-(2-phenylethyl)-3,7-diazatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene-2,4-dione |
| SMILES | NCCc1cccc(-c2ccc(CCN3C(=O)c4cccc5c(-c6ncc7c8c(cccc68)C(=O)N(CCc6ccccc6)C7=O)ccc(c45)C3=O)cc2)c1 |
| InChI | InChI=1S/C47H36N4O4/c48-24-21-31-9-4-10-33(27-31)32-17-15-30(16-18-32)23-26-50-44(52)37-13-5-11-34-35(19-20-39(41(34)37)46(50)54)43-36-12-6-14-38-42(36)40(28-49-43)47(55)51(45(38)53)25-22-29-7-2-1-3-8-29/h1-20,27-28H,21-26,48H2 |
| InChIKey | IMWQROFYWTVVOJ-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.83 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|