C16H13N3S — CID 16721071
N-phenyl-4,5-dihydro-[1,3]thiazino[5,6-b]indol-2-amine (PubChem CID 16721071) has the molecular formula C16H13N3S and a molecular weight of 279.37 g/mol. Its IUPAC name is N-phenyl-4,5-dihydro-[1,3]thiazino[5,6-b]indol-2-amine.
| Compound Name | N-phenyl-4,5-dihydro-[1,3]thiazino[5,6-b]indol-2-amine |
|---|---|
| PubChem CID | 16721071 |
| Molecular Formula | C16H13N3S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | N-phenyl-4,5-dihydro-[1,3]thiazino[5,6-b]indol-2-amine |
| SMILES | c1ccc(NC2=NCc3[nH]c4ccccc4c3S2)cc1 |
| InChI | InChI=1S/C16H13N3S/c1-2-6-11(7-3-1)18-16-17-10-14-15(20-16)12-8-4-5-9-13(12)19-14/h1-9,19H,10H2,(H,17,18) |
| InChIKey | PVZMQKWBGBLSIY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |