C36H37N3 — CID 167210743
(2E,4Z)-N'-benzyl-N,2-dimethyl-N-(methylideneamino)-6-[2-methyl-3-(2-methyl-3-phenylphenyl)phenyl]hexa-2,4-dienimidamide (PubChem CID 167210743) has the molecular formula C36H37N3 and a molecular weight of 511.71 g/mol. Its IUPAC name is (2E,4Z)-N'-benzyl-N,2-dimethyl-N-(methylideneamino)-6-[2-methyl-3-(2-methyl-3-phenylphenyl)phenyl]hexa-2,4-dienimidamide.
| Compound Name | (2E,4Z)-N'-benzyl-N,2-dimethyl-N-(methylideneamino)-6-[2-methyl-3-(2-methyl-3-phenylphenyl)phenyl]hexa-2,4-dienimidamide |
|---|---|
| PubChem CID | 167210743 |
| Molecular Formula | C36H37N3 |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.30 |
| IUPAC Name | (2E,4Z)-N'-benzyl-N,2-dimethyl-N-(methylideneamino)-6-[2-methyl-3-(2-methyl-3-phenylphenyl)phenyl]hexa-2,4-dienimidamide |
| SMILES | C=NN(C)C(=N\Cc1ccccc1)/C(C)=C/C=C\Cc1cccc(-c2cccc(-c3ccccc3)c2C)c1C |
| InChI | InChI=1S/C36H37N3/c1-27(36(39(5)37-4)38-26-30-17-8-6-9-18-30)16-12-13-19-31-22-14-24-34(28(31)2)35-25-15-23-33(29(35)3)32-20-10-7-11-21-32/h6-18,20-25H,4,19,26H2,1-3,5H3/b13-12-,27-16+,38-36- |
| InChIKey | FNICSHFDIKMCEO-YJNUNAFTSA-N |
| XLogP | 8.83 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|