About 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)thiadiazole
5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)thiadiazole (PubChem CID 16721103) has the molecular formula C18H18N2O4S
and a molecular weight of 358.42 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)thiadiazole.
Molecular Properties
| Compound Name | 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)thiadiazole |
| PubChem CID | 16721103 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)thiadiazole |
| SMILES | COc1ccc(-c2snnc2-c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C18H18N2O4S/c1-21-13-7-5-11(6-8-13)18-16(19-20-25-18)12-9-14(22-2)17(24-4)15(10-12)23-3/h5-10H,1-4H3 |
| InChIKey | SIWFHHPZEQONJG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)thiadiazole?
The IUPAC name of 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)thiadiazole (CID 16721103) is 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)thiadiazole.
What is the SMILES notation for 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)thiadiazole?
The canonical SMILES for 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)thiadiazole is COc1ccc(-c2snnc2-c2cc(OC)c(OC)c(OC)c2)cc1.
What is the InChIKey of 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)thiadiazole?
The InChIKey is SIWFHHPZEQONJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O4S/c1-21-13-7-5-11(6-8-13)18-16(19-20-25-18)12-9-14(22-2)17(24-4)15(10-12)23-3/h5-10H,1-4H3.
What are the key properties of 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)thiadiazole?
5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)thiadiazole has a molecular weight of 358.42 g/mol, XLogP of 3.91, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methoxyphenyl)-4-(3,4,5-trimethoxyphenyl)thiadiazole is sourced from PubChem (CID 16721103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).