About bis(2-[butyl(pyridine-3-carbonyl)amino]ethyl pyridine-3-carboxylate);hydrate
bis(2-[butyl(pyridine-3-carbonyl)amino]ethyl pyridine-3-carboxylate);hydrate (PubChem CID 16721171) has the molecular formula C36H44N6O7
and a molecular weight of 672.78 g/mol. Its IUPAC name is bis(2-[butyl(pyridine-3-carbonyl)amino]ethyl pyridine-3-carboxylate);hydrate.
Molecular Properties
| Compound Name | bis(2-[butyl(pyridine-3-carbonyl)amino]ethyl pyridine-3-carboxylate);hydrate |
| PubChem CID | 16721171 |
| Molecular Formula | C36H44N6O7 |
| Molecular Weight | 672.78 g/mol |
| Exact Mass | 672.33 |
| IUPAC Name | bis(2-[butyl(pyridine-3-carbonyl)amino]ethyl pyridine-3-carboxylate);hydrate |
| SMILES | CCCCN(CCOC(=O)c1cccnc1)C(=O)c1cccnc1.CCCCN(CCOC(=O)c1cccnc1)C(=O)c1cccnc1.O |
| InChI | InChI=1S/2C18H21N3O3.H2O/c2*1-2-3-10-21(17(22)15-6-4-8-19-13-15)11-12-24-18(23)16-7-5-9-20-14-16;/h2*4-9,13-14H,2-3,10-12H2,1H3;1H2 |
| InChIKey | ONGJMUMNHRVISS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 176.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 672.78 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze bis(2-[butyl(pyridine-3-carbonyl)amino]ethyl pyridine-3-carboxylate);hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-[butyl(pyridine-3-carbonyl)amino]ethyl pyridine-3-carboxylate);hydrate?
The IUPAC name of bis(2-[butyl(pyridine-3-carbonyl)amino]ethyl pyridine-3-carboxylate);hydrate (CID 16721171) is bis(2-[butyl(pyridine-3-carbonyl)amino]ethyl pyridine-3-carboxylate);hydrate.
What is the SMILES notation for bis(2-[butyl(pyridine-3-carbonyl)amino]ethyl pyridine-3-carboxylate);hydrate?
The canonical SMILES for bis(2-[butyl(pyridine-3-carbonyl)amino]ethyl pyridine-3-carboxylate);hydrate is CCCCN(CCOC(=O)c1cccnc1)C(=O)c1cccnc1.CCCCN(CCOC(=O)c1cccnc1)C(=O)c1cccnc1.O.
What is the InChIKey of bis(2-[butyl(pyridine-3-carbonyl)amino]ethyl pyridine-3-carboxylate);hydrate?
The InChIKey is ONGJMUMNHRVISS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C18H21N3O3.H2O/c2*1-2-3-10-21(17(22)15-6-4-8-19-13-15)11-12-24-18(23)16-7-5-9-20-14-16;/h2*4-9,13-14H,2-3,10-12H2,1H3;1H2.
What are the key properties of bis(2-[butyl(pyridine-3-carbonyl)amino]ethyl pyridine-3-carboxylate);hydrate?
bis(2-[butyl(pyridine-3-carbonyl)amino]ethyl pyridine-3-carboxylate);hydrate has a molecular weight of 672.78 g/mol, XLogP of 4.33, 16 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-[butyl(pyridine-3-carbonyl)amino]ethyl pyridine-3-carboxylate);hydrate is sourced from PubChem (CID 16721171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).