C24H27F7N4O3 — CID 167212395
(2R,3S,4S,5R)-N-[1-(difluoromethyl)-3-methylpyrazol-4-yl]-3-[3,4-difluoro-2-(morpholin-4-ylmethyl)phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide (PubChem CID 167212395) has the molecular formula C24H27F7N4O3 and a molecular weight of 552.49 g/mol. Its IUPAC name is (2R,3S,4S,5R)-N-[1-(difluoromethyl)-3-methylpyrazol-4-yl]-3-[3,4-difluoro-2-(morpholin-4-ylmethyl)phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4S,5R)-N-[1-(difluoromethyl)-3-methylpyrazol-4-yl]-3-[3,4-difluoro-2-(morpholin-4-ylmethyl)phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 167212395 |
| Molecular Formula | C24H27F7N4O3 |
| Molecular Weight | 552.49 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | (2R,3S,4S,5R)-N-[1-(difluoromethyl)-3-methylpyrazol-4-yl]-3-[3,4-difluoro-2-(morpholin-4-ylmethyl)phenyl]-4,5-dimethyl-5-(trifluoromethyl)oxolane-2-carboxamide |
| SMILES | Cc1nn(C(F)F)cc1NC(=O)[C@@H]1O[C@@](C)(C(F)(F)F)[C@@H](C)[C@H]1c1ccc(F)c(F)c1CN1CCOCC1 |
| InChI | InChI=1S/C24H27F7N4O3/c1-12-18(14-4-5-16(25)19(26)15(14)10-34-6-8-37-9-7-34)20(38-23(12,3)24(29,30)31)21(36)32-17-11-35(22(27)28)33-13(17)2/h4-5,11-12,18,20,22H,6-10H2,1-3H3,(H,32,36)/t12-,18-,20+,23+/m0/s1 |
| InChIKey | YEOKSSNXJJDEQG-USZFSJBGSA-N |
| XLogP | 4.78 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |