About (9-methyl-10-oxoundecyl) 3-acetylpyrrolidine-1-carboxylate
(9-methyl-10-oxoundecyl) 3-acetylpyrrolidine-1-carboxylate (PubChem CID 167213249) has the molecular formula C19H33NO4
and a molecular weight of 339.48 g/mol. Its IUPAC name is (9-methyl-10-oxoundecyl) 3-acetylpyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | (9-methyl-10-oxoundecyl) 3-acetylpyrrolidine-1-carboxylate |
| PubChem CID | 167213249 |
| Molecular Formula | C19H33NO4 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | (9-methyl-10-oxoundecyl) 3-acetylpyrrolidine-1-carboxylate |
| SMILES | CC(=O)C(C)CCCCCCCCOC(=O)N1CCC(C(C)=O)C1 |
| InChI | InChI=1S/C19H33NO4/c1-15(16(2)21)10-8-6-4-5-7-9-13-24-19(23)20-12-11-18(14-20)17(3)22/h15,18H,4-14H2,1-3H3 |
| InChIKey | UYFPJFAMLXMNOJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (9-methyl-10-oxoundecyl) 3-acetylpyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-methyl-10-oxoundecyl) 3-acetylpyrrolidine-1-carboxylate?
The IUPAC name of (9-methyl-10-oxoundecyl) 3-acetylpyrrolidine-1-carboxylate (CID 167213249) is (9-methyl-10-oxoundecyl) 3-acetylpyrrolidine-1-carboxylate.
What is the SMILES notation for (9-methyl-10-oxoundecyl) 3-acetylpyrrolidine-1-carboxylate?
The canonical SMILES for (9-methyl-10-oxoundecyl) 3-acetylpyrrolidine-1-carboxylate is CC(=O)C(C)CCCCCCCCOC(=O)N1CCC(C(C)=O)C1.
What is the InChIKey of (9-methyl-10-oxoundecyl) 3-acetylpyrrolidine-1-carboxylate?
The InChIKey is UYFPJFAMLXMNOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H33NO4/c1-15(16(2)21)10-8-6-4-5-7-9-13-24-19(23)20-12-11-18(14-20)17(3)22/h15,18H,4-14H2,1-3H3.
What are the key properties of (9-methyl-10-oxoundecyl) 3-acetylpyrrolidine-1-carboxylate?
(9-methyl-10-oxoundecyl) 3-acetylpyrrolidine-1-carboxylate has a molecular weight of 339.48 g/mol, XLogP of 3.99, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (9-methyl-10-oxoundecyl) 3-acetylpyrrolidine-1-carboxylate is sourced from PubChem (CID 167213249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).