About N-(6-chlorocyclohexa-1,5-dien-1-yl)propanamide
N-(6-chlorocyclohexa-1,5-dien-1-yl)propanamide (PubChem CID 167213695) has the molecular formula C9H12ClNO
and a molecular weight of 185.65 g/mol. Its IUPAC name is N-(6-chlorocyclohexa-1,5-dien-1-yl)propanamide.
Molecular Properties
| Compound Name | N-(6-chlorocyclohexa-1,5-dien-1-yl)propanamide |
| PubChem CID | 167213695 |
| Molecular Formula | C9H12ClNO |
| Molecular Weight | 185.65 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | N-(6-chlorocyclohexa-1,5-dien-1-yl)propanamide |
| SMILES | CCC(=O)NC1=CCCC=C1Cl |
| InChI | InChI=1S/C9H12ClNO/c1-2-9(12)11-8-6-4-3-5-7(8)10/h5-6H,2-4H2,1H3,(H,11,12) |
| InChIKey | ARKFXUYWWUTGFZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.65 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(6-chlorocyclohexa-1,5-dien-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-chlorocyclohexa-1,5-dien-1-yl)propanamide?
The IUPAC name of N-(6-chlorocyclohexa-1,5-dien-1-yl)propanamide (CID 167213695) is N-(6-chlorocyclohexa-1,5-dien-1-yl)propanamide.
What is the SMILES notation for N-(6-chlorocyclohexa-1,5-dien-1-yl)propanamide?
The canonical SMILES for N-(6-chlorocyclohexa-1,5-dien-1-yl)propanamide is CCC(=O)NC1=CCCC=C1Cl.
What is the InChIKey of N-(6-chlorocyclohexa-1,5-dien-1-yl)propanamide?
The InChIKey is ARKFXUYWWUTGFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClNO/c1-2-9(12)11-8-6-4-3-5-7(8)10/h5-6H,2-4H2,1H3,(H,11,12).
What are the key properties of N-(6-chlorocyclohexa-1,5-dien-1-yl)propanamide?
N-(6-chlorocyclohexa-1,5-dien-1-yl)propanamide has a molecular weight of 185.65 g/mol, XLogP of 2.31, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-chlorocyclohexa-1,5-dien-1-yl)propanamide is sourced from PubChem (CID 167213695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).