C10H12FN — CID 167213704
4-fluoro-2-methyl-1,5,8,8a-tetrahydrocyclohepta[b]pyrrole (PubChem CID 167213704) has the molecular formula C10H12FN and a molecular weight of 165.21 g/mol. Its IUPAC name is 4-fluoro-2-methyl-1,5,8,8a-tetrahydrocyclohepta[b]pyrrole.
| Compound Name | 4-fluoro-2-methyl-1,5,8,8a-tetrahydrocyclohepta[b]pyrrole |
|---|---|
| PubChem CID | 167213704 |
| Molecular Formula | C10H12FN |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 4-fluoro-2-methyl-1,5,8,8a-tetrahydrocyclohepta[b]pyrrole |
| SMILES | CC1=CC2=C(F)CC=CCC2N1 |
| InChI | InChI=1S/C10H12FN/c1-7-6-8-9(11)4-2-3-5-10(8)12-7/h2-3,6,10,12H,4-5H2,1H3 |
| InChIKey | DKRNGBHOSSREJM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|