C9H16F3NOS — CID 167213708
N-[(3S)-2,4-dimethyl-1-sulfanylpentan-3-yl]-2,2,2-trifluoroacetamide (PubChem CID 167213708) has the molecular formula C9H16F3NOS and a molecular weight of 243.29 g/mol. Its IUPAC name is N-[(3S)-2,4-dimethyl-1-sulfanylpentan-3-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(3S)-2,4-dimethyl-1-sulfanylpentan-3-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 167213708 |
| Molecular Formula | C9H16F3NOS |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | N-[(3S)-2,4-dimethyl-1-sulfanylpentan-3-yl]-2,2,2-trifluoroacetamide |
| SMILES | CC(C)[C@H](NC(=O)C(F)(F)F)C(C)CS |
| InChI | InChI=1S/C9H16F3NOS/c1-5(2)7(6(3)4-15)13-8(14)9(10,11)12/h5-7,15H,4H2,1-3H3,(H,13,14)/t6?,7-/m0/s1 |
| InChIKey | JQXSZSIBRZAXPU-MLWJPKLSSA-N |
| XLogP | 2.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|