About (2E,3Z)-2-(3,3-dimethylbutylidene)-3-prop-2-enylidenebenzo[g][1]benzothiole
(2E,3Z)-2-(3,3-dimethylbutylidene)-3-prop-2-enylidenebenzo[g][1]benzothiole (PubChem CID 167214744) has the molecular formula C21H22S
and a molecular weight of 306.47 g/mol. Its IUPAC name is (2E,3Z)-2-(3,3-dimethylbutylidene)-3-prop-2-enylidenebenzo[g][1]benzothiole.
Molecular Properties
| Compound Name | (2E,3Z)-2-(3,3-dimethylbutylidene)-3-prop-2-enylidenebenzo[g][1]benzothiole |
| PubChem CID | 167214744 |
| Molecular Formula | C21H22S |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (2E,3Z)-2-(3,3-dimethylbutylidene)-3-prop-2-enylidenebenzo[g][1]benzothiole |
| SMILES | C=C/C=c1\c(=C/CC(C)(C)C)sc2c1ccc1ccccc12 |
| InChI | InChI=1S/C21H22S/c1-5-8-17-18-12-11-15-9-6-7-10-16(15)20(18)22-19(17)13-14-21(2,3)4/h5-13H,1,14H2,2-4H3/b17-8-,19-13+ |
| InChIKey | UUOWRIXSVFDPDC-SXRXVLNNSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2E,3Z)-2-(3,3-dimethylbutylidene)-3-prop-2-enylidenebenzo[g][1]benzothiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3Z)-2-(3,3-dimethylbutylidene)-3-prop-2-enylidenebenzo[g][1]benzothiole?
The IUPAC name of (2E,3Z)-2-(3,3-dimethylbutylidene)-3-prop-2-enylidenebenzo[g][1]benzothiole (CID 167214744) is (2E,3Z)-2-(3,3-dimethylbutylidene)-3-prop-2-enylidenebenzo[g][1]benzothiole.
What is the SMILES notation for (2E,3Z)-2-(3,3-dimethylbutylidene)-3-prop-2-enylidenebenzo[g][1]benzothiole?
The canonical SMILES for (2E,3Z)-2-(3,3-dimethylbutylidene)-3-prop-2-enylidenebenzo[g][1]benzothiole is C=C/C=c1\c(=C/CC(C)(C)C)sc2c1ccc1ccccc12.
What is the InChIKey of (2E,3Z)-2-(3,3-dimethylbutylidene)-3-prop-2-enylidenebenzo[g][1]benzothiole?
The InChIKey is UUOWRIXSVFDPDC-SXRXVLNNSA-N. The full InChI is InChI=1S/C21H22S/c1-5-8-17-18-12-11-15-9-6-7-10-16(15)20(18)22-19(17)13-14-21(2,3)4/h5-13H,1,14H2,2-4H3/b17-8-,19-13+.
What are the key properties of (2E,3Z)-2-(3,3-dimethylbutylidene)-3-prop-2-enylidenebenzo[g][1]benzothiole?
(2E,3Z)-2-(3,3-dimethylbutylidene)-3-prop-2-enylidenebenzo[g][1]benzothiole has a molecular weight of 306.47 g/mol, XLogP of 5.24, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3Z)-2-(3,3-dimethylbutylidene)-3-prop-2-enylidenebenzo[g][1]benzothiole is sourced from PubChem (CID 167214744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).