About 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-methoxy-7,8-dimethylquinazoline
4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-methoxy-7,8-dimethylquinazoline (PubChem CID 167214822) has the molecular formula C17H22N4O
and a molecular weight of 298.39 g/mol. Its IUPAC name is 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-methoxy-7,8-dimethylquinazoline.
Molecular Properties
| Compound Name | 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-methoxy-7,8-dimethylquinazoline |
| PubChem CID | 167214822 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-methoxy-7,8-dimethylquinazoline |
| SMILES | COc1nc(N2CC3CCC(C2)N3)c2ccc(C)c(C)c2n1 |
| InChI | InChI=1S/C17H22N4O/c1-10-4-7-14-15(11(10)2)19-17(22-3)20-16(14)21-8-12-5-6-13(9-21)18-12/h4,7,12-13,18H,5-6,8-9H2,1-3H3 |
| InChIKey | NOFZSVSGRWYAGQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-methoxy-7,8-dimethylquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-methoxy-7,8-dimethylquinazoline?
The IUPAC name of 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-methoxy-7,8-dimethylquinazoline (CID 167214822) is 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-methoxy-7,8-dimethylquinazoline.
What is the SMILES notation for 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-methoxy-7,8-dimethylquinazoline?
The canonical SMILES for 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-methoxy-7,8-dimethylquinazoline is COc1nc(N2CC3CCC(C2)N3)c2ccc(C)c(C)c2n1.
What is the InChIKey of 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-methoxy-7,8-dimethylquinazoline?
The InChIKey is NOFZSVSGRWYAGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O/c1-10-4-7-14-15(11(10)2)19-17(22-3)20-16(14)21-8-12-5-6-13(9-21)18-12/h4,7,12-13,18H,5-6,8-9H2,1-3H3.
What are the key properties of 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-methoxy-7,8-dimethylquinazoline?
4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-methoxy-7,8-dimethylquinazoline has a molecular weight of 298.39 g/mol, XLogP of 2.20, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-methoxy-7,8-dimethylquinazoline is sourced from PubChem (CID 167214822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).