About 6-ethyl-2-propan-2-yl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine
6-ethyl-2-propan-2-yl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 167214863) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is 6-ethyl-2-propan-2-yl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 6-ethyl-2-propan-2-yl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine |
| PubChem CID | 167214863 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 6-ethyl-2-propan-2-yl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | CCc1ccc2n1CCN(C(C)C)C2 |
| InChI | InChI=1S/C12H20N2/c1-4-11-5-6-12-9-13(10(2)3)7-8-14(11)12/h5-6,10H,4,7-9H2,1-3H3 |
| InChIKey | XGLAWFGTSBVHRY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethyl-2-propan-2-yl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-2-propan-2-yl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine?
The IUPAC name of 6-ethyl-2-propan-2-yl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine (CID 167214863) is 6-ethyl-2-propan-2-yl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine.
What is the SMILES notation for 6-ethyl-2-propan-2-yl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine?
The canonical SMILES for 6-ethyl-2-propan-2-yl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine is CCc1ccc2n1CCN(C(C)C)C2.
What is the InChIKey of 6-ethyl-2-propan-2-yl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine?
The InChIKey is XGLAWFGTSBVHRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2/c1-4-11-5-6-12-9-13(10(2)3)7-8-14(11)12/h5-6,10H,4,7-9H2,1-3H3.
What are the key properties of 6-ethyl-2-propan-2-yl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine?
6-ethyl-2-propan-2-yl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine has a molecular weight of 192.31 g/mol, XLogP of 2.27, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-2-propan-2-yl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine is sourced from PubChem (CID 167214863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).