C21H34N2 — CID 167215336
N'-[(4E,6Z)-6-cyclohexyl-5-methyl-3-methylideneocta-4,6-dien-4-yl]-N-prop-1-en-2-ylethanimidamide (PubChem CID 167215336) has the molecular formula C21H34N2 and a molecular weight of 314.52 g/mol. Its IUPAC name is N'-[(4E,6Z)-6-cyclohexyl-5-methyl-3-methylideneocta-4,6-dien-4-yl]-N-prop-1-en-2-ylethanimidamide.
| Compound Name | N'-[(4E,6Z)-6-cyclohexyl-5-methyl-3-methylideneocta-4,6-dien-4-yl]-N-prop-1-en-2-ylethanimidamide |
|---|---|
| PubChem CID | 167215336 |
| Molecular Formula | C21H34N2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | N'-[(4E,6Z)-6-cyclohexyl-5-methyl-3-methylideneocta-4,6-dien-4-yl]-N-prop-1-en-2-ylethanimidamide |
| SMILES | C=C(C)N/C(C)=N/C(C(=C)CC)=C(C)/C(=C\C)C1CCCCC1 |
| InChI | InChI=1S/C21H34N2/c1-8-16(5)21(23-18(7)22-15(3)4)17(6)20(9-2)19-13-11-10-12-14-19/h9,19H,3,5,8,10-14H2,1-2,4,6-7H3,(H,22,23)/b20-9+,21-17+ |
| InChIKey | UJMVOUXEZZGJLQ-ZPOBTFBFSA-N |
| XLogP | 6.29 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|