C19H30FN — CID 167215678
4-ethyl-1-[(2E,4E,6E)-5-fluoronona-2,4,6-trien-2-yl]-5-propan-2-yl-3,6-dihydro-2H-pyridine (PubChem CID 167215678) has the molecular formula C19H30FN and a molecular weight of 291.45 g/mol. Its IUPAC name is 4-ethyl-1-[(2E,4E,6E)-5-fluoronona-2,4,6-trien-2-yl]-5-propan-2-yl-3,6-dihydro-2H-pyridine.
| Compound Name | 4-ethyl-1-[(2E,4E,6E)-5-fluoronona-2,4,6-trien-2-yl]-5-propan-2-yl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 167215678 |
| Molecular Formula | C19H30FN |
| Molecular Weight | 291.45 g/mol |
| Exact Mass | 291.24 |
| IUPAC Name | 4-ethyl-1-[(2E,4E,6E)-5-fluoronona-2,4,6-trien-2-yl]-5-propan-2-yl-3,6-dihydro-2H-pyridine |
| SMILES | CC/C=C/C(F)=C\C=C(/C)N1CCC(CC)=C(C(C)C)C1 |
| InChI | InChI=1S/C19H30FN/c1-6-8-9-18(20)11-10-16(5)21-13-12-17(7-2)19(14-21)15(3)4/h8-11,15H,6-7,12-14H2,1-5H3/b9-8+,16-10+,18-11+ |
| InChIKey | OALXIGOEKGYXFZ-IIVHQCOISA-N |
| XLogP | 5.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.45 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|