C15H18N2 — CID 167215704
6-[(1Z,3Z)-2-buta-1,3-dien-2-ylpenta-1,3-dienyl]-5-methylpyridin-2-amine (PubChem CID 167215704) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 6-[(1Z,3Z)-2-buta-1,3-dien-2-ylpenta-1,3-dienyl]-5-methylpyridin-2-amine.
| Compound Name | 6-[(1Z,3Z)-2-buta-1,3-dien-2-ylpenta-1,3-dienyl]-5-methylpyridin-2-amine |
|---|---|
| PubChem CID | 167215704 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 6-[(1Z,3Z)-2-buta-1,3-dien-2-ylpenta-1,3-dienyl]-5-methylpyridin-2-amine |
| SMILES | C=CC(=C)C(=Cc1nc(N)ccc1C)/C=C\C |
| InChI | InChI=1S/C15H18N2/c1-5-7-13(11(3)6-2)10-14-12(4)8-9-15(16)17-14/h5-10H,2-3H2,1,4H3,(H2,16,17)/b7-5-,13-10- |
| InChIKey | UYIZGMHFDDZUGH-GSOVPNJMSA-N |
| XLogP | 3.67 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|