C16H26O — CID 167215789
4-[(3E,5E)-4,5,6-trimethylocta-1,3,5-trien-3-yl]oxane (PubChem CID 167215789) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is 4-[(3E,5E)-4,5,6-trimethylocta-1,3,5-trien-3-yl]oxane.
| Compound Name | 4-[(3E,5E)-4,5,6-trimethylocta-1,3,5-trien-3-yl]oxane |
|---|---|
| PubChem CID | 167215789 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 4-[(3E,5E)-4,5,6-trimethylocta-1,3,5-trien-3-yl]oxane |
| SMILES | C=C/C(=C(C)\C(C)=C(/C)CC)C1CCOCC1 |
| InChI | InChI=1S/C16H26O/c1-6-12(3)13(4)14(5)16(7-2)15-8-10-17-11-9-15/h7,15H,2,6,8-11H2,1,3-5H3/b13-12+,16-14+ |
| InChIKey | YWFWRDJSCFOYMG-OBURPCBNSA-N |
| XLogP | 4.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|