About (2E,3Z)-2,3-di(ethylidene)-1H-benzo[g]indole
(2E,3Z)-2,3-di(ethylidene)-1H-benzo[g]indole (PubChem CID 167215822) has the molecular formula C16H15N
and a molecular weight of 221.30 g/mol. Its IUPAC name is (2E,3Z)-2,3-di(ethylidene)-1H-benzo[g]indole.
Molecular Properties
| Compound Name | (2E,3Z)-2,3-di(ethylidene)-1H-benzo[g]indole |
| PubChem CID | 167215822 |
| Molecular Formula | C16H15N |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (2E,3Z)-2,3-di(ethylidene)-1H-benzo[g]indole |
| SMILES | C/C=c1\c(=C/C)[nH]c2c1ccc1ccccc12 |
| InChI | InChI=1S/C16H15N/c1-3-12-14-10-9-11-7-5-6-8-13(11)16(14)17-15(12)4-2/h3-10,17H,1-2H3/b12-3-,15-4+ |
| InChIKey | FFFRHXFJZNNOLS-LIQIKVCDSA-N |
| XLogP | 2.92 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (2E,3Z)-2,3-di(ethylidene)-1H-benzo[g]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3Z)-2,3-di(ethylidene)-1H-benzo[g]indole?
The IUPAC name of (2E,3Z)-2,3-di(ethylidene)-1H-benzo[g]indole (CID 167215822) is (2E,3Z)-2,3-di(ethylidene)-1H-benzo[g]indole.
What is the SMILES notation for (2E,3Z)-2,3-di(ethylidene)-1H-benzo[g]indole?
The canonical SMILES for (2E,3Z)-2,3-di(ethylidene)-1H-benzo[g]indole is C/C=c1\c(=C/C)[nH]c2c1ccc1ccccc12.
What is the InChIKey of (2E,3Z)-2,3-di(ethylidene)-1H-benzo[g]indole?
The InChIKey is FFFRHXFJZNNOLS-LIQIKVCDSA-N. The full InChI is InChI=1S/C16H15N/c1-3-12-14-10-9-11-7-5-6-8-13(11)16(14)17-15(12)4-2/h3-10,17H,1-2H3/b12-3-,15-4+.
What are the key properties of (2E,3Z)-2,3-di(ethylidene)-1H-benzo[g]indole?
(2E,3Z)-2,3-di(ethylidene)-1H-benzo[g]indole has a molecular weight of 221.30 g/mol, XLogP of 2.92, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3Z)-2,3-di(ethylidene)-1H-benzo[g]indole is sourced from PubChem (CID 167215822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).