C26H52N2 — CID 167216309
N-buta-1,3-dien-2-yl-6-butan-2-yl-6-hexyl-N'-methylundecane-1,11-diamine (PubChem CID 167216309) has the molecular formula C26H52N2 and a molecular weight of 392.72 g/mol. Its IUPAC name is N-buta-1,3-dien-2-yl-6-butan-2-yl-6-hexyl-N'-methylundecane-1,11-diamine.
| Compound Name | N-buta-1,3-dien-2-yl-6-butan-2-yl-6-hexyl-N'-methylundecane-1,11-diamine |
|---|---|
| PubChem CID | 167216309 |
| Molecular Formula | C26H52N2 |
| Molecular Weight | 392.72 g/mol |
| Exact Mass | 392.41 |
| IUPAC Name | N-buta-1,3-dien-2-yl-6-butan-2-yl-6-hexyl-N'-methylundecane-1,11-diamine |
| SMILES | C=CC(=C)NCCCCCC(CCCCCC)(CCCCCNC)C(C)CC |
| InChI | InChI=1S/C26H52N2/c1-7-10-11-14-19-26(24(4)8-2,20-15-12-17-22-27-6)21-16-13-18-23-28-25(5)9-3/h9,24,27-28H,3,5,7-8,10-23H2,1-2,4,6H3 |
| InChIKey | CFQDWIXFBZXZRE-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.72 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|