C18H28FN3O — CID 167216675
(3S)-6-[2-(4-fluoro-3-methylcyclohex-3-en-1-yl)pyrrolidin-3-yl]-2,3,5,6,7,7a-hexahydro-1H-pyrrolo[1,2-c]imidazole-3-carbaldehyde (PubChem CID 167216675) has the molecular formula C18H28FN3O and a molecular weight of 321.44 g/mol. Its IUPAC name is (3S)-6-[2-(4-fluoro-3-methylcyclohex-3-en-1-yl)pyrrolidin-3-yl]-2,3,5,6,7,7a-hexahydro-1H-pyrrolo[1,2-c]imidazole-3-carbaldehyde.
| Compound Name | (3S)-6-[2-(4-fluoro-3-methylcyclohex-3-en-1-yl)pyrrolidin-3-yl]-2,3,5,6,7,7a-hexahydro-1H-pyrrolo[1,2-c]imidazole-3-carbaldehyde |
|---|---|
| PubChem CID | 167216675 |
| Molecular Formula | C18H28FN3O |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | (3S)-6-[2-(4-fluoro-3-methylcyclohex-3-en-1-yl)pyrrolidin-3-yl]-2,3,5,6,7,7a-hexahydro-1H-pyrrolo[1,2-c]imidazole-3-carbaldehyde |
| SMILES | CC1=C(F)CCC(C2NCCC2C2CC3CN[C@H](C=O)N3C2)C1 |
| InChI | InChI=1S/C18H28FN3O/c1-11-6-12(2-3-16(11)19)18-15(4-5-20-18)13-7-14-8-21-17(10-23)22(14)9-13/h10,12-15,17-18,20-21H,2-9H2,1H3/t12?,13?,14?,15?,17-,18?/m0/s1 |
| InChIKey | CEINYKYDGIVLSG-HRWDSRQLSA-N |
| XLogP | 1.83 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|