C16H23ClFN3 — CID 167216833
2-chloro-6-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]-1,4,5,6-tetrahydropyrimidine (PubChem CID 167216833) has the molecular formula C16H23ClFN3 and a molecular weight of 311.83 g/mol. Its IUPAC name is 2-chloro-6-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 2-chloro-6-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 167216833 |
| Molecular Formula | C16H23ClFN3 |
| Molecular Weight | 311.83 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 2-chloro-6-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]-1,4,5,6-tetrahydropyrimidine |
| SMILES | CC1CC(C2NCCC=C2C2CCN=C(Cl)N2)C=CC1F |
| InChI | InChI=1S/C16H23ClFN3/c1-10-9-11(4-5-13(10)18)15-12(3-2-7-19-15)14-6-8-20-16(17)21-14/h3-5,10-11,13-15,19H,2,6-9H2,1H3,(H,20,21) |
| InChIKey | CBCLJZFJEGDCSQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.83 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|