About (2Z)-6-[2-(3-chloro-2,4-difluorophenyl)-3-iodophenyl]-2-prop-2-enylidene-1H-pyrimidine
(2Z)-6-[2-(3-chloro-2,4-difluorophenyl)-3-iodophenyl]-2-prop-2-enylidene-1H-pyrimidine (PubChem CID 167216855) has the molecular formula C19H12ClF2IN2
and a molecular weight of 468.67 g/mol. Its IUPAC name is (2Z)-6-[2-(3-chloro-2,4-difluorophenyl)-3-iodophenyl]-2-prop-2-enylidene-1H-pyrimidine.
Molecular Properties
| Compound Name | (2Z)-6-[2-(3-chloro-2,4-difluorophenyl)-3-iodophenyl]-2-prop-2-enylidene-1H-pyrimidine |
| PubChem CID | 167216855 |
| Molecular Formula | C19H12ClF2IN2 |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 467.97 |
| IUPAC Name | (2Z)-6-[2-(3-chloro-2,4-difluorophenyl)-3-iodophenyl]-2-prop-2-enylidene-1H-pyrimidine |
| SMILES | C=C/C=C1\N=CC=C(c2cccc(I)c2-c2ccc(F)c(Cl)c2F)N1 |
| InChI | InChI=1S/C19H12ClF2IN2/c1-2-4-16-24-10-9-15(25-16)11-5-3-6-14(23)17(11)12-7-8-13(21)18(20)19(12)22/h2-10,25H,1H2/b16-4+ |
| InChIKey | ZJXSYTSQKORVRA-AYSLTRBKSA-N |
| XLogP | 5.93 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-6-[2-(3-chloro-2,4-difluorophenyl)-3-iodophenyl]-2-prop-2-enylidene-1H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-6-[2-(3-chloro-2,4-difluorophenyl)-3-iodophenyl]-2-prop-2-enylidene-1H-pyrimidine?
The IUPAC name of (2Z)-6-[2-(3-chloro-2,4-difluorophenyl)-3-iodophenyl]-2-prop-2-enylidene-1H-pyrimidine (CID 167216855) is (2Z)-6-[2-(3-chloro-2,4-difluorophenyl)-3-iodophenyl]-2-prop-2-enylidene-1H-pyrimidine.
What is the SMILES notation for (2Z)-6-[2-(3-chloro-2,4-difluorophenyl)-3-iodophenyl]-2-prop-2-enylidene-1H-pyrimidine?
The canonical SMILES for (2Z)-6-[2-(3-chloro-2,4-difluorophenyl)-3-iodophenyl]-2-prop-2-enylidene-1H-pyrimidine is C=C/C=C1\N=CC=C(c2cccc(I)c2-c2ccc(F)c(Cl)c2F)N1.
What is the InChIKey of (2Z)-6-[2-(3-chloro-2,4-difluorophenyl)-3-iodophenyl]-2-prop-2-enylidene-1H-pyrimidine?
The InChIKey is ZJXSYTSQKORVRA-AYSLTRBKSA-N. The full InChI is InChI=1S/C19H12ClF2IN2/c1-2-4-16-24-10-9-15(25-16)11-5-3-6-14(23)17(11)12-7-8-13(21)18(20)19(12)22/h2-10,25H,1H2/b16-4+.
What are the key properties of (2Z)-6-[2-(3-chloro-2,4-difluorophenyl)-3-iodophenyl]-2-prop-2-enylidene-1H-pyrimidine?
(2Z)-6-[2-(3-chloro-2,4-difluorophenyl)-3-iodophenyl]-2-prop-2-enylidene-1H-pyrimidine has a molecular weight of 468.67 g/mol, XLogP of 5.93, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-6-[2-(3-chloro-2,4-difluorophenyl)-3-iodophenyl]-2-prop-2-enylidene-1H-pyrimidine is sourced from PubChem (CID 167216855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).