C25H36FN3 — CID 167216968
3-cyclohex-2-en-1-yl-7-[2-(4-fluoro-3-methylcyclohex-3-en-1-yl)-1,2-dihydropyridin-3-yl]-1,2,3,5,6,7,8,8a-octahydroimidazo[1,5-a]pyridine (PubChem CID 167216968) has the molecular formula C25H36FN3 and a molecular weight of 397.58 g/mol. Its IUPAC name is 3-cyclohex-2-en-1-yl-7-[2-(4-fluoro-3-methylcyclohex-3-en-1-yl)-1,2-dihydropyridin-3-yl]-1,2,3,5,6,7,8,8a-octahydroimidazo[1,5-a]pyridine.
| Compound Name | 3-cyclohex-2-en-1-yl-7-[2-(4-fluoro-3-methylcyclohex-3-en-1-yl)-1,2-dihydropyridin-3-yl]-1,2,3,5,6,7,8,8a-octahydroimidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 167216968 |
| Molecular Formula | C25H36FN3 |
| Molecular Weight | 397.58 g/mol |
| Exact Mass | 397.29 |
| IUPAC Name | 3-cyclohex-2-en-1-yl-7-[2-(4-fluoro-3-methylcyclohex-3-en-1-yl)-1,2-dihydropyridin-3-yl]-1,2,3,5,6,7,8,8a-octahydroimidazo[1,5-a]pyridine |
| SMILES | CC1=C(F)CCC(C2NC=CC=C2C2CCN3C(CNC3C3C=CCCC3)C2)C1 |
| InChI | InChI=1S/C25H36FN3/c1-17-14-20(9-10-23(17)26)24-22(8-5-12-27-24)19-11-13-29-21(15-19)16-28-25(29)18-6-3-2-4-7-18/h3,5-6,8,12,18-21,24-25,27-28H,2,4,7,9-11,13-16H2,1H3 |
| InChIKey | IVMFOICAAASCPT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|