C20H34FN3 — CID 167217054
2-ethylimino-6-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]hexan-1-amine (PubChem CID 167217054) has the molecular formula C20H34FN3 and a molecular weight of 335.51 g/mol. Its IUPAC name is 2-ethylimino-6-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]hexan-1-amine.
| Compound Name | 2-ethylimino-6-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]hexan-1-amine |
|---|---|
| PubChem CID | 167217054 |
| Molecular Formula | C20H34FN3 |
| Molecular Weight | 335.51 g/mol |
| Exact Mass | 335.27 |
| IUPAC Name | 2-ethylimino-6-[6-(4-fluoro-5-methylcyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]hexan-1-amine |
| SMILES | CC/N=C(\CN)CCCCC1=CCCNC1C1C=CC(F)C(C)C1 |
| InChI | InChI=1S/C20H34FN3/c1-3-23-18(14-22)9-5-4-7-16-8-6-12-24-20(16)17-10-11-19(21)15(2)13-17/h8,10-11,15,17,19-20,24H,3-7,9,12-14,22H2,1-2H3/b23-18- |
| InChIKey | FFDMCQYSGLUACW-NKFKGCMQSA-N |
| XLogP | 3.81 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|