C16H23ClFN3 — CID 167217057
(4R)-4-[6-(3-chloro-6-fluorocyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]-2,3,4,5-tetrahydropyridin-6-amine (PubChem CID 167217057) has the molecular formula C16H23ClFN3 and a molecular weight of 311.83 g/mol. Its IUPAC name is (4R)-4-[6-(3-chloro-6-fluorocyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]-2,3,4,5-tetrahydropyridin-6-amine.
| Compound Name | (4R)-4-[6-(3-chloro-6-fluorocyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]-2,3,4,5-tetrahydropyridin-6-amine |
|---|---|
| PubChem CID | 167217057 |
| Molecular Formula | C16H23ClFN3 |
| Molecular Weight | 311.83 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (4R)-4-[6-(3-chloro-6-fluorocyclohex-2-en-1-yl)-1,2,3,6-tetrahydropyridin-5-yl]-2,3,4,5-tetrahydropyridin-6-amine |
| SMILES | NC1=NCC[C@@H](C2=CCCNC2C2C=C(Cl)CCC2F)C1 |
| InChI | InChI=1S/C16H23ClFN3/c17-11-3-4-14(18)13(9-11)16-12(2-1-6-21-16)10-5-7-20-15(19)8-10/h2,9-10,13-14,16,21H,1,3-8H2,(H2,19,20)/t10-,13?,14?,16?/m1/s1 |
| InChIKey | HIUBGFGVPHQELS-ZCVCMULBSA-N |
| XLogP | 2.91 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.83 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|