About 6-iodo-2,3-dihydroimidazo[1,2-a]pyridine
6-iodo-2,3-dihydroimidazo[1,2-a]pyridine (PubChem CID 167217293) has the molecular formula C7H7IN2
and a molecular weight of 246.05 g/mol. Its IUPAC name is 6-iodo-2,3-dihydroimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 6-iodo-2,3-dihydroimidazo[1,2-a]pyridine |
| PubChem CID | 167217293 |
| Molecular Formula | C7H7IN2 |
| Molecular Weight | 246.05 g/mol |
| Exact Mass | 245.97 |
| IUPAC Name | 6-iodo-2,3-dihydroimidazo[1,2-a]pyridine |
| SMILES | IC1=CN2CCN=C2C=C1 |
| InChI | InChI=1S/C7H7IN2/c8-6-1-2-7-9-3-4-10(7)5-6/h1-2,5H,3-4H2 |
| InChIKey | XODRNCBJNPGLNG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.05 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-2,3-dihydroimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-2,3-dihydroimidazo[1,2-a]pyridine?
The IUPAC name of 6-iodo-2,3-dihydroimidazo[1,2-a]pyridine (CID 167217293) is 6-iodo-2,3-dihydroimidazo[1,2-a]pyridine.
What is the SMILES notation for 6-iodo-2,3-dihydroimidazo[1,2-a]pyridine?
The canonical SMILES for 6-iodo-2,3-dihydroimidazo[1,2-a]pyridine is IC1=CN2CCN=C2C=C1.
What is the InChIKey of 6-iodo-2,3-dihydroimidazo[1,2-a]pyridine?
The InChIKey is XODRNCBJNPGLNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7IN2/c8-6-1-2-7-9-3-4-10(7)5-6/h1-2,5H,3-4H2.
What are the key properties of 6-iodo-2,3-dihydroimidazo[1,2-a]pyridine?
6-iodo-2,3-dihydroimidazo[1,2-a]pyridine has a molecular weight of 246.05 g/mol, XLogP of 1.55, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-2,3-dihydroimidazo[1,2-a]pyridine is sourced from PubChem (CID 167217293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).