C28H24F2N6O3S — CID 167217862
5-[2-[1-(3,4-difluorophenyl)-6-oxopiperidin-2-yl]-7-(3,5-dimethyl-1,2-oxazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-N-methyl-1,2-thiazole-3-carboxamide (PubChem CID 167217862) has the molecular formula C28H24F2N6O3S and a molecular weight of 562.60 g/mol. Its IUPAC name is 5-[2-[1-(3,4-difluorophenyl)-6-oxopiperidin-2-yl]-7-(3,5-dimethyl-1,2-oxazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-N-methyl-1,2-thiazole-3-carboxamide.
| Compound Name | 5-[2-[1-(3,4-difluorophenyl)-6-oxopiperidin-2-yl]-7-(3,5-dimethyl-1,2-oxazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-N-methyl-1,2-thiazole-3-carboxamide |
|---|---|
| PubChem CID | 167217862 |
| Molecular Formula | C28H24F2N6O3S |
| Molecular Weight | 562.60 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | 5-[2-[1-(3,4-difluorophenyl)-6-oxopiperidin-2-yl]-7-(3,5-dimethyl-1,2-oxazol-4-yl)imidazo[1,2-a]pyridin-3-yl]-N-methyl-1,2-thiazole-3-carboxamide |
| SMILES | CNC(=O)c1cc(-c2c(C3CCCC(=O)N3c3ccc(F)c(F)c3)nc3cc(-c4c(C)noc4C)ccn23)sn1 |
| InChI | InChI=1S/C28H24F2N6O3S/c1-14-25(15(2)39-33-14)16-9-10-35-23(11-16)32-26(27(35)22-13-20(34-40-22)28(38)31-3)21-5-4-6-24(37)36(21)17-7-8-18(29)19(30)12-17/h7-13,21H,4-6H2,1-3H3,(H,31,38) |
| InChIKey | WFYNDUQYZXTOKI-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 105.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |