C18H37NO — CID 167218317
N-(2,2,5,5,7,7-hexamethylnonyl)-3-methyloxiran-2-amine (PubChem CID 167218317) has the molecular formula C18H37NO and a molecular weight of 283.50 g/mol. Its IUPAC name is N-(2,2,5,5,7,7-hexamethylnonyl)-3-methyloxiran-2-amine.
| Compound Name | N-(2,2,5,5,7,7-hexamethylnonyl)-3-methyloxiran-2-amine |
|---|---|
| PubChem CID | 167218317 |
| Molecular Formula | C18H37NO |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.29 |
| IUPAC Name | N-(2,2,5,5,7,7-hexamethylnonyl)-3-methyloxiran-2-amine |
| SMILES | CCC(C)(C)CC(C)(C)CCC(C)(C)CNC1OC1C |
| InChI | InChI=1S/C18H37NO/c1-9-16(3,4)12-17(5,6)10-11-18(7,8)13-19-15-14(2)20-15/h14-15,19H,9-13H2,1-8H3 |
| InChIKey | HJOGXDKHXWFYCF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 24.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|