C16H8F18O3 — CID 167218419
2-[2,3-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 167218419) has the molecular formula C16H8F18O3 and a molecular weight of 590.20 g/mol. Its IUPAC name is 2-[2,3-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2,3-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 167218419 |
| Molecular Formula | C16H8F18O3 |
| Molecular Weight | 590.20 g/mol |
| Exact Mass | 590.02 |
| IUPAC Name | 2-[2,3-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Cc1ccc(C(O)(C(F)(F)F)C(F)(F)F)c(C(O)(C(F)(F)F)C(F)(F)F)c1C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H8F18O3/c1-4-2-3-5(8(35,11(17,18)19)12(20,21)22)7(10(37,15(29,30)31)16(32,33)34)6(4)9(36,13(23,24)25)14(26,27)28/h2-3,35-37H,1H3 |
| InChIKey | PYEMCJHLBSVSOZ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.20 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |