About N'-(1-benzothiophen-4-yl)-N-(3-ethylheptyl)-N'-(fluoromethyl)ethane-1,2-diamine
N'-(1-benzothiophen-4-yl)-N-(3-ethylheptyl)-N'-(fluoromethyl)ethane-1,2-diamine (PubChem CID 167218645) has the molecular formula C20H31FN2S
and a molecular weight of 350.55 g/mol. Its IUPAC name is N'-(1-benzothiophen-4-yl)-N-(3-ethylheptyl)-N'-(fluoromethyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(1-benzothiophen-4-yl)-N-(3-ethylheptyl)-N'-(fluoromethyl)ethane-1,2-diamine |
| PubChem CID | 167218645 |
| Molecular Formula | C20H31FN2S |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | N'-(1-benzothiophen-4-yl)-N-(3-ethylheptyl)-N'-(fluoromethyl)ethane-1,2-diamine |
| SMILES | CCCCC(CC)CCNCCN(CF)c1cccc2sccc12 |
| InChI | InChI=1S/C20H31FN2S/c1-3-5-7-17(4-2)10-12-22-13-14-23(16-21)19-8-6-9-20-18(19)11-15-24-20/h6,8-9,11,15,17,22H,3-5,7,10,12-14,16H2,1-2H3 |
| InChIKey | LCNPFJPTTXBLEY-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N'-(1-benzothiophen-4-yl)-N-(3-ethylheptyl)-N'-(fluoromethyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1-benzothiophen-4-yl)-N-(3-ethylheptyl)-N'-(fluoromethyl)ethane-1,2-diamine?
The IUPAC name of N'-(1-benzothiophen-4-yl)-N-(3-ethylheptyl)-N'-(fluoromethyl)ethane-1,2-diamine (CID 167218645) is N'-(1-benzothiophen-4-yl)-N-(3-ethylheptyl)-N'-(fluoromethyl)ethane-1,2-diamine.
What is the SMILES notation for N'-(1-benzothiophen-4-yl)-N-(3-ethylheptyl)-N'-(fluoromethyl)ethane-1,2-diamine?
The canonical SMILES for N'-(1-benzothiophen-4-yl)-N-(3-ethylheptyl)-N'-(fluoromethyl)ethane-1,2-diamine is CCCCC(CC)CCNCCN(CF)c1cccc2sccc12.
What is the InChIKey of N'-(1-benzothiophen-4-yl)-N-(3-ethylheptyl)-N'-(fluoromethyl)ethane-1,2-diamine?
The InChIKey is LCNPFJPTTXBLEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31FN2S/c1-3-5-7-17(4-2)10-12-22-13-14-23(16-21)19-8-6-9-20-18(19)11-15-24-20/h6,8-9,11,15,17,22H,3-5,7,10,12-14,16H2,1-2H3.
What are the key properties of N'-(1-benzothiophen-4-yl)-N-(3-ethylheptyl)-N'-(fluoromethyl)ethane-1,2-diamine?
N'-(1-benzothiophen-4-yl)-N-(3-ethylheptyl)-N'-(fluoromethyl)ethane-1,2-diamine has a molecular weight of 350.55 g/mol, XLogP of 5.83, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1-benzothiophen-4-yl)-N-(3-ethylheptyl)-N'-(fluoromethyl)ethane-1,2-diamine is sourced from PubChem (CID 167218645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).