C24H28N4O3 — CID 167218866
1-[5-[2-hydroxy-3-[3-[2-(propylamino)ethylamino]-1,2-oxazol-5-yl]phenyl]-2,3-dihydroindol-1-yl]ethanone (PubChem CID 167218866) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is 1-[5-[2-hydroxy-3-[3-[2-(propylamino)ethylamino]-1,2-oxazol-5-yl]phenyl]-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 1-[5-[2-hydroxy-3-[3-[2-(propylamino)ethylamino]-1,2-oxazol-5-yl]phenyl]-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 167218866 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 1-[5-[2-hydroxy-3-[3-[2-(propylamino)ethylamino]-1,2-oxazol-5-yl]phenyl]-2,3-dihydroindol-1-yl]ethanone |
| SMILES | CCCNCCNc1cc(-c2cccc(-c3ccc4c(c3)CCN4C(C)=O)c2O)on1 |
| InChI | InChI=1S/C24H28N4O3/c1-3-10-25-11-12-26-23-15-22(31-27-23)20-6-4-5-19(24(20)30)17-7-8-21-18(14-17)9-13-28(21)16(2)29/h4-8,14-15,25,30H,3,9-13H2,1-2H3,(H,26,27) |
| InChIKey | KEEWRHPPQJIMBE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|